C33H37ClFN3O — CID 118666822
[3-[[1-(3-chloropropyl)-2,3-dimethylindol-5-yl]methyl]phenyl]-[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]methanone (PubChem CID 118666822) has the molecular formula C33H37ClFN3O and a molecular weight of 546.13 g/mol. Its IUPAC name is [3-[[1-(3-chloropropyl)-2,3-dimethylindol-5-yl]methyl]phenyl]-[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]methanone.
| Compound Name | [3-[[1-(3-chloropropyl)-2,3-dimethylindol-5-yl]methyl]phenyl]-[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 118666822 |
| Molecular Formula | C33H37ClFN3O |
| Molecular Weight | 546.13 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | [3-[[1-(3-chloropropyl)-2,3-dimethylindol-5-yl]methyl]phenyl]-[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]methanone |
| SMILES | Cc1c(C)n(CCCCl)c2ccc(Cc3cccc(C(=O)N4CCN(CCc5ccc(F)cc5)CC4)c3)cc12 |
| InChI | InChI=1S/C33H37ClFN3O/c1-24-25(2)38(15-4-14-34)32-12-9-28(23-31(24)32)21-27-5-3-6-29(22-27)33(39)37-19-17-36(18-20-37)16-13-26-7-10-30(35)11-8-26/h3,5-12,22-23H,4,13-21H2,1-2H3 |
| InChIKey | IQJBBMACGUZFNS-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.13 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|