C37H47N5O3 — CID 144997415
[4-[2-(3,4-dihydroxyphenyl)ethyl]piperazin-1-yl]-[4-[[2,3-dimethyl-1-(3-piperazin-1-ylpropyl)indol-5-yl]methyl]phenyl]methanone (PubChem CID 144997415) has the molecular formula C37H47N5O3 and a molecular weight of 609.82 g/mol. Its IUPAC name is [4-[2-(3,4-dihydroxyphenyl)ethyl]piperazin-1-yl]-[4-[[2,3-dimethyl-1-(3-piperazin-1-ylpropyl)indol-5-yl]methyl]phenyl]methanone.
| Compound Name | [4-[2-(3,4-dihydroxyphenyl)ethyl]piperazin-1-yl]-[4-[[2,3-dimethyl-1-(3-piperazin-1-ylpropyl)indol-5-yl]methyl]phenyl]methanone |
|---|---|
| PubChem CID | 144997415 |
| Molecular Formula | C37H47N5O3 |
| Molecular Weight | 609.82 g/mol |
| Exact Mass | 609.37 |
| IUPAC Name | [4-[2-(3,4-dihydroxyphenyl)ethyl]piperazin-1-yl]-[4-[[2,3-dimethyl-1-(3-piperazin-1-ylpropyl)indol-5-yl]methyl]phenyl]methanone |
| SMILES | Cc1c(C)n(CCCN2CCNCC2)c2ccc(Cc3ccc(C(=O)N4CCN(CCc5ccc(O)c(O)c5)CC4)cc3)cc12 |
| InChI | InChI=1S/C37H47N5O3/c1-27-28(2)42(16-3-15-39-18-13-38-14-19-39)34-10-6-31(25-33(27)34)24-29-4-8-32(9-5-29)37(45)41-22-20-40(21-23-41)17-12-30-7-11-35(43)36(44)26-30/h4-11,25-26,38,43-44H,3,12-24H2,1-2H3 |
| InChIKey | ZSYRZKYZDLSERP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|