C30H32FN3O — CID 118666781
[4-[(2,3-dimethyl-1H-indol-5-yl)methyl]phenyl]-[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]methanone (PubChem CID 118666781) has the molecular formula C30H32FN3O and a molecular weight of 469.60 g/mol. Its IUPAC name is [4-[(2,3-dimethyl-1H-indol-5-yl)methyl]phenyl]-[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]methanone.
| Compound Name | [4-[(2,3-dimethyl-1H-indol-5-yl)methyl]phenyl]-[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 118666781 |
| Molecular Formula | C30H32FN3O |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | [4-[(2,3-dimethyl-1H-indol-5-yl)methyl]phenyl]-[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]methanone |
| SMILES | Cc1[nH]c2ccc(Cc3ccc(C(=O)N4CCN(CCc5ccc(F)cc5)CC4)cc3)cc2c1C |
| InChI | InChI=1S/C30H32FN3O/c1-21-22(2)32-29-12-7-25(20-28(21)29)19-24-3-8-26(9-4-24)30(35)34-17-15-33(16-18-34)14-13-23-5-10-27(31)11-6-23/h3-12,20,32H,13-19H2,1-2H3 |
| InChIKey | MDFPJUXNSBZOAF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|