C35H37N3O2 — CID 118666898
[4-[(2,3-dimethyl-1H-indol-5-yl)methyl]phenyl]-[4-[2-(6-methoxynaphthalen-2-yl)ethyl]piperazin-1-yl]methanone (PubChem CID 118666898) has the molecular formula C35H37N3O2 and a molecular weight of 531.70 g/mol. Its IUPAC name is [4-[(2,3-dimethyl-1H-indol-5-yl)methyl]phenyl]-[4-[2-(6-methoxynaphthalen-2-yl)ethyl]piperazin-1-yl]methanone.
| Compound Name | [4-[(2,3-dimethyl-1H-indol-5-yl)methyl]phenyl]-[4-[2-(6-methoxynaphthalen-2-yl)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 118666898 |
| Molecular Formula | C35H37N3O2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | [4-[(2,3-dimethyl-1H-indol-5-yl)methyl]phenyl]-[4-[2-(6-methoxynaphthalen-2-yl)ethyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc2cc(CCN3CCN(C(=O)c4ccc(Cc5ccc6[nH]c(C)c(C)c6c5)cc4)CC3)ccc2c1 |
| InChI | InChI=1S/C35H37N3O2/c1-24-25(2)36-34-13-7-28(22-33(24)34)20-26-4-8-29(9-5-26)35(39)38-18-16-37(17-19-38)15-14-27-6-10-31-23-32(40-3)12-11-30(31)21-27/h4-13,21-23,36H,14-20H2,1-3H3 |
| InChIKey | BFAYXLAYHBAVBZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|