C26H31ClFN3O2 — CID 129186965
[1-(3-chloropropyl)-5-methoxy-2-methylindol-3-yl]-[4-[2-(3-fluorophenyl)ethyl]piperazin-1-yl]methanone (PubChem CID 129186965) has the molecular formula C26H31ClFN3O2 and a molecular weight of 472.00 g/mol. Its IUPAC name is [1-(3-chloropropyl)-5-methoxy-2-methylindol-3-yl]-[4-[2-(3-fluorophenyl)ethyl]piperazin-1-yl]methanone.
| Compound Name | [1-(3-chloropropyl)-5-methoxy-2-methylindol-3-yl]-[4-[2-(3-fluorophenyl)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 129186965 |
| Molecular Formula | C26H31ClFN3O2 |
| Molecular Weight | 472.00 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | [1-(3-chloropropyl)-5-methoxy-2-methylindol-3-yl]-[4-[2-(3-fluorophenyl)ethyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc2c(c1)c(C(=O)N1CCN(CCc3cccc(F)c3)CC1)c(C)n2CCCCl |
| InChI | InChI=1S/C26H31ClFN3O2/c1-19-25(23-18-22(33-2)7-8-24(23)31(19)11-4-10-27)26(32)30-15-13-29(14-16-30)12-9-20-5-3-6-21(28)17-20/h3,5-8,17-18H,4,9-16H2,1-2H3 |
| InChIKey | XQUJULJSUCKOMN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|