C23H26FN3O2 — CID 4897477
(1-ethyl-5-methoxy-2-methylindol-3-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 4897477) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is (1-ethyl-5-methoxy-2-methylindol-3-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | (1-ethyl-5-methoxy-2-methylindol-3-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4897477 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (1-ethyl-5-methoxy-2-methylindol-3-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | CCn1c(C)c(C(=O)N2CCN(c3ccccc3F)CC2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C23H26FN3O2/c1-4-27-16(2)22(18-15-17(29-3)9-10-20(18)27)23(28)26-13-11-25(12-14-26)21-8-6-5-7-19(21)24/h5-10,15H,4,11-14H2,1-3H3 |
| InChIKey | FBLRXBYGFZSNBP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |