C20H18F2N2O2S — CID 50846112
(5-fluoro-3-methoxy-1-benzothiophen-2-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 50846112) has the molecular formula C20H18F2N2O2S and a molecular weight of 388.44 g/mol. Its IUPAC name is (5-fluoro-3-methoxy-1-benzothiophen-2-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | (5-fluoro-3-methoxy-1-benzothiophen-2-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 50846112 |
| Molecular Formula | C20H18F2N2O2S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (5-fluoro-3-methoxy-1-benzothiophen-2-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | COc1c(C(=O)N2CCN(c3ccccc3F)CC2)sc2ccc(F)cc12 |
| InChI | InChI=1S/C20H18F2N2O2S/c1-26-18-14-12-13(21)6-7-17(14)27-19(18)20(25)24-10-8-23(9-11-24)16-5-3-2-4-15(16)22/h2-7,12H,8-11H2,1H3 |
| InChIKey | TVPQMHQZPGHAHA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |