C21H21FN2O2S — CID 50845694
(4-fluoro-3-methoxy-1-benzothiophen-2-yl)-[4-(2-methylphenyl)piperazin-1-yl]methanone (PubChem CID 50845694) has the molecular formula C21H21FN2O2S and a molecular weight of 384.48 g/mol. Its IUPAC name is (4-fluoro-3-methoxy-1-benzothiophen-2-yl)-[4-(2-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | (4-fluoro-3-methoxy-1-benzothiophen-2-yl)-[4-(2-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 50845694 |
| Molecular Formula | C21H21FN2O2S |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (4-fluoro-3-methoxy-1-benzothiophen-2-yl)-[4-(2-methylphenyl)piperazin-1-yl]methanone |
| SMILES | COc1c(C(=O)N2CCN(c3ccccc3C)CC2)sc2cccc(F)c12 |
| InChI | InChI=1S/C21H21FN2O2S/c1-14-6-3-4-8-16(14)23-10-12-24(13-11-23)21(25)20-19(26-2)18-15(22)7-5-9-17(18)27-20/h3-9H,10-13H2,1-2H3 |
| InChIKey | LFQGZYIVHOQQCU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |