C19H20F2N2O3 — CID 113079869
[4-(2,4-difluorophenyl)piperazin-1-yl]-(3,5-dimethoxyphenyl)methanone (PubChem CID 113079869) has the molecular formula C19H20F2N2O3 and a molecular weight of 362.38 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)piperazin-1-yl]-(3,5-dimethoxyphenyl)methanone.
| Compound Name | [4-(2,4-difluorophenyl)piperazin-1-yl]-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 113079869 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [4-(2,4-difluorophenyl)piperazin-1-yl]-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(c3ccc(F)cc3F)CC2)c1 |
| InChI | InChI=1S/C19H20F2N2O3/c1-25-15-9-13(10-16(12-15)26-2)19(24)23-7-5-22(6-8-23)18-4-3-14(20)11-17(18)21/h3-4,9-12H,5-8H2,1-2H3 |
| InChIKey | OQUKVOPNMVXVPT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |