C19H17ClF4N2O3 — CID 17335532
[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]-(3,5-dimethoxyphenyl)methanone (PubChem CID 17335532) has the molecular formula C19H17ClF4N2O3 and a molecular weight of 432.80 g/mol. Its IUPAC name is [4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]-(3,5-dimethoxyphenyl)methanone.
| Compound Name | [4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 17335532 |
| Molecular Formula | C19H17ClF4N2O3 |
| Molecular Weight | 432.80 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | [4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(c3c(F)c(F)c(Cl)c(F)c3F)CC2)c1 |
| InChI | InChI=1S/C19H17ClF4N2O3/c1-28-11-7-10(8-12(9-11)29-2)19(27)26-5-3-25(4-6-26)18-16(23)14(21)13(20)15(22)17(18)24/h7-9H,3-6H2,1-2H3 |
| InChIKey | HQSAUZNIFSZTJR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.80 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|