C20H21FN4O3 — CID 11625164
2-amino-5-[4-(3,5-dimethoxyphenyl)piperazine-1-carbonyl]-3-fluorobenzonitrile (PubChem CID 11625164) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-amino-5-[4-(3,5-dimethoxyphenyl)piperazine-1-carbonyl]-3-fluorobenzonitrile.
| Compound Name | 2-amino-5-[4-(3,5-dimethoxyphenyl)piperazine-1-carbonyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 11625164 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-amino-5-[4-(3,5-dimethoxyphenyl)piperazine-1-carbonyl]-3-fluorobenzonitrile |
| SMILES | COc1cc(OC)cc(N2CCN(C(=O)c3cc(F)c(N)c(C#N)c3)CC2)c1 |
| InChI | InChI=1S/C20H21FN4O3/c1-27-16-9-15(10-17(11-16)28-2)24-3-5-25(6-4-24)20(26)13-7-14(12-22)19(23)18(21)8-13/h7-11H,3-6,23H2,1-2H3 |
| InChIKey | XNGAMAATUFCHCG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|