C22H23FN4O2 — CID 110373209
[4-(2-fluorophenyl)piperazin-1-yl]-[1-(3-methoxyphenyl)-5-methylpyrazol-3-yl]methanone (PubChem CID 110373209) has the molecular formula C22H23FN4O2 and a molecular weight of 394.45 g/mol. Its IUPAC name is [4-(2-fluorophenyl)piperazin-1-yl]-[1-(3-methoxyphenyl)-5-methylpyrazol-3-yl]methanone.
| Compound Name | [4-(2-fluorophenyl)piperazin-1-yl]-[1-(3-methoxyphenyl)-5-methylpyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 110373209 |
| Molecular Formula | C22H23FN4O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [4-(2-fluorophenyl)piperazin-1-yl]-[1-(3-methoxyphenyl)-5-methylpyrazol-3-yl]methanone |
| SMILES | COc1cccc(-n2nc(C(=O)N3CCN(c4ccccc4F)CC3)cc2C)c1 |
| InChI | InChI=1S/C22H23FN4O2/c1-16-14-20(24-27(16)17-6-5-7-18(15-17)29-2)22(28)26-12-10-25(11-13-26)21-9-4-3-8-19(21)23/h3-9,14-15H,10-13H2,1-2H3 |
| InChIKey | FDBQNAFGWSWSBP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |