C18H21ClN4O3 — CID 110373026
ethyl 4-[1-(3-chlorophenyl)-5-methylpyrazole-3-carbonyl]piperazine-1-carboxylate (PubChem CID 110373026) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is ethyl 4-[1-(3-chlorophenyl)-5-methylpyrazole-3-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-(3-chlorophenyl)-5-methylpyrazole-3-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110373026 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | ethyl 4-[1-(3-chlorophenyl)-5-methylpyrazole-3-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc(C)n(-c3cccc(Cl)c3)n2)CC1 |
| InChI | InChI=1S/C18H21ClN4O3/c1-3-26-18(25)22-9-7-21(8-10-22)17(24)16-11-13(2)23(20-16)15-6-4-5-14(19)12-15/h4-6,11-12H,3,7-10H2,1-2H3 |
| InChIKey | YRAPKJDLPHATIY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |