C26H26FN5O — CID 20940239
[1-[(4-fluorophenyl)methyl]-2,3-dimethylindol-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 20940239) has the molecular formula C26H26FN5O and a molecular weight of 443.53 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methyl]-2,3-dimethylindol-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [1-[(4-fluorophenyl)methyl]-2,3-dimethylindol-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 20940239 |
| Molecular Formula | C26H26FN5O |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | [1-[(4-fluorophenyl)methyl]-2,3-dimethylindol-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | Cc1c(C)n(Cc2ccc(F)cc2)c2ccc(C(=O)N3CCN(c4ncccn4)CC3)cc12 |
| InChI | InChI=1S/C26H26FN5O/c1-18-19(2)32(17-20-4-7-22(27)8-5-20)24-9-6-21(16-23(18)24)25(33)30-12-14-31(15-13-30)26-28-10-3-11-29-26/h3-11,16H,12-15,17H2,1-2H3 |
| InChIKey | JSDDXVGGJXKTFB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|