C26H25FN2O — CID 20876874
N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1-[(3-methylphenyl)methyl]indole-5-carboxamide (PubChem CID 20876874) has the molecular formula C26H25FN2O and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1-[(3-methylphenyl)methyl]indole-5-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1-[(3-methylphenyl)methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 20876874 |
| Molecular Formula | C26H25FN2O |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1-[(3-methylphenyl)methyl]indole-5-carboxamide |
| SMILES | Cc1cccc(Cn2c(C)c(C)c3cc(C(=O)NCc4ccc(F)cc4)ccc32)c1 |
| InChI | InChI=1S/C26H25FN2O/c1-17-5-4-6-21(13-17)16-29-19(3)18(2)24-14-22(9-12-25(24)29)26(30)28-15-20-7-10-23(27)11-8-20/h4-14H,15-16H2,1-3H3,(H,28,30) |
| InChIKey | ITOLTEFOWPIWQO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|