C28H30N2O — CID 20888436
2,3-dimethyl-N-[2-(2-methylphenyl)ethyl]-1-[(3-methylphenyl)methyl]indole-5-carboxamide (PubChem CID 20888436) has the molecular formula C28H30N2O and a molecular weight of 410.56 g/mol. Its IUPAC name is 2,3-dimethyl-N-[2-(2-methylphenyl)ethyl]-1-[(3-methylphenyl)methyl]indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-N-[2-(2-methylphenyl)ethyl]-1-[(3-methylphenyl)methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 20888436 |
| Molecular Formula | C28H30N2O |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 2,3-dimethyl-N-[2-(2-methylphenyl)ethyl]-1-[(3-methylphenyl)methyl]indole-5-carboxamide |
| SMILES | Cc1cccc(Cn2c(C)c(C)c3cc(C(=O)NCCc4ccccc4C)ccc32)c1 |
| InChI | InChI=1S/C28H30N2O/c1-19-8-7-10-23(16-19)18-30-22(4)21(3)26-17-25(12-13-27(26)30)28(31)29-15-14-24-11-6-5-9-20(24)2/h5-13,16-17H,14-15,18H2,1-4H3,(H,29,31) |
| InChIKey | YIEFJFJATDYXKF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|