C30H33FN4O — CID 142593241
[1-benzyl-7-[(4-fluorophenyl)methylamino]-2,3-dimethylindol-5-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 142593241) has the molecular formula C30H33FN4O and a molecular weight of 484.62 g/mol. Its IUPAC name is [1-benzyl-7-[(4-fluorophenyl)methylamino]-2,3-dimethylindol-5-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [1-benzyl-7-[(4-fluorophenyl)methylamino]-2,3-dimethylindol-5-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 142593241 |
| Molecular Formula | C30H33FN4O |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | [1-benzyl-7-[(4-fluorophenyl)methylamino]-2,3-dimethylindol-5-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2c(NCc3ccc(F)cc3)cc(C(=O)N3CCN(C)CC3)cc12 |
| InChI | InChI=1S/C30H33FN4O/c1-21-22(2)35(20-24-7-5-4-6-8-24)29-27(21)17-25(30(36)34-15-13-33(3)14-16-34)18-28(29)32-19-23-9-11-26(31)12-10-23/h4-12,17-18,32H,13-16,19-20H2,1-3H3 |
| InChIKey | DFPBQXBVDMAAOV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|