C29H37FN4O — CID 142593353
[1-(cyclopentylmethyl)-7-[(4-fluorophenyl)methylamino]-2,3-dimethylindol-5-yl]-(1,4-diazepan-1-yl)methanone (PubChem CID 142593353) has the molecular formula C29H37FN4O and a molecular weight of 476.64 g/mol. Its IUPAC name is [1-(cyclopentylmethyl)-7-[(4-fluorophenyl)methylamino]-2,3-dimethylindol-5-yl]-(1,4-diazepan-1-yl)methanone.
| Compound Name | [1-(cyclopentylmethyl)-7-[(4-fluorophenyl)methylamino]-2,3-dimethylindol-5-yl]-(1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 142593353 |
| Molecular Formula | C29H37FN4O |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | [1-(cyclopentylmethyl)-7-[(4-fluorophenyl)methylamino]-2,3-dimethylindol-5-yl]-(1,4-diazepan-1-yl)methanone |
| SMILES | Cc1c(C)n(CC2CCCC2)c2c(NCc3ccc(F)cc3)cc(C(=O)N3CCCNCC3)cc12 |
| InChI | InChI=1S/C29H37FN4O/c1-20-21(2)34(19-23-6-3-4-7-23)28-26(20)16-24(29(35)33-14-5-12-31-13-15-33)17-27(28)32-18-22-8-10-25(30)11-9-22/h8-11,16-17,23,31-32H,3-7,12-15,18-19H2,1-2H3 |
| InChIKey | JFURUDDOHCSGNY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|