C27H33FN4O — CID 142593146
(4-ethylpiperazin-1-yl)-[7-[(4-fluorophenyl)methylamino]-2,3-dimethyl-1-prop-2-enylindol-5-yl]methanone (PubChem CID 142593146) has the molecular formula C27H33FN4O and a molecular weight of 448.59 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[7-[(4-fluorophenyl)methylamino]-2,3-dimethyl-1-prop-2-enylindol-5-yl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[7-[(4-fluorophenyl)methylamino]-2,3-dimethyl-1-prop-2-enylindol-5-yl]methanone |
|---|---|
| PubChem CID | 142593146 |
| Molecular Formula | C27H33FN4O |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[7-[(4-fluorophenyl)methylamino]-2,3-dimethyl-1-prop-2-enylindol-5-yl]methanone |
| SMILES | C=CCn1c(C)c(C)c2cc(C(=O)N3CCN(CC)CC3)cc(NCc3ccc(F)cc3)c21 |
| InChI | InChI=1S/C27H33FN4O/c1-5-11-32-20(4)19(3)24-16-22(27(33)31-14-12-30(6-2)13-15-31)17-25(26(24)32)29-18-21-7-9-23(28)10-8-21/h5,7-10,16-17,29H,1,6,11-15,18H2,2-4H3 |
| InChIKey | LNUKBQJCORMPDL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|