C28H36N4O — CID 142593303
[7-[(2,6-dimethylphenyl)methylamino]-2,3-dimethyl-1-prop-2-enylindol-5-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 142593303) has the molecular formula C28H36N4O and a molecular weight of 444.62 g/mol. Its IUPAC name is [7-[(2,6-dimethylphenyl)methylamino]-2,3-dimethyl-1-prop-2-enylindol-5-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [7-[(2,6-dimethylphenyl)methylamino]-2,3-dimethyl-1-prop-2-enylindol-5-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 142593303 |
| Molecular Formula | C28H36N4O |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | [7-[(2,6-dimethylphenyl)methylamino]-2,3-dimethyl-1-prop-2-enylindol-5-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | C=CCn1c(C)c(C)c2cc(C(=O)N3CCN(C)CC3)cc(NCc3c(C)cccc3C)c21 |
| InChI | InChI=1S/C28H36N4O/c1-7-11-32-22(5)21(4)24-16-23(28(33)31-14-12-30(6)13-15-31)17-26(27(24)32)29-18-25-19(2)9-8-10-20(25)3/h7-10,16-17,29H,1,11-15,18H2,2-6H3 |
| InChIKey | RZFUCTHABAZAMA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|