C27H33FN4O — CID 142593179
[1-(cyclopropylmethyl)-7-[(4-fluoro-2-methylphenyl)methylamino]-2,3-dimethylindol-5-yl]-piperazin-1-ylmethanone (PubChem CID 142593179) has the molecular formula C27H33FN4O and a molecular weight of 448.59 g/mol. Its IUPAC name is [1-(cyclopropylmethyl)-7-[(4-fluoro-2-methylphenyl)methylamino]-2,3-dimethylindol-5-yl]-piperazin-1-ylmethanone.
| Compound Name | [1-(cyclopropylmethyl)-7-[(4-fluoro-2-methylphenyl)methylamino]-2,3-dimethylindol-5-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 142593179 |
| Molecular Formula | C27H33FN4O |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | [1-(cyclopropylmethyl)-7-[(4-fluoro-2-methylphenyl)methylamino]-2,3-dimethylindol-5-yl]-piperazin-1-ylmethanone |
| SMILES | Cc1cc(F)ccc1CNc1cc(C(=O)N2CCNCC2)cc2c(C)c(C)n(CC3CC3)c12 |
| InChI | InChI=1S/C27H33FN4O/c1-17-12-23(28)7-6-21(17)15-30-25-14-22(27(33)31-10-8-29-9-11-31)13-24-18(2)19(3)32(26(24)25)16-20-4-5-20/h6-7,12-14,20,29-30H,4-5,8-11,15-16H2,1-3H3 |
| InChIKey | IXMTWUHWZMGDKE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|