C25H30ClFN4O2 — CID 142593197
[7-[(2-chloro-4-fluorophenyl)methylamino]-2,3-dimethyl-1H-indol-5-yl]-[4-(2-methoxyethyl)piperazin-1-yl]methanone (PubChem CID 142593197) has the molecular formula C25H30ClFN4O2 and a molecular weight of 472.99 g/mol. Its IUPAC name is [7-[(2-chloro-4-fluorophenyl)methylamino]-2,3-dimethyl-1H-indol-5-yl]-[4-(2-methoxyethyl)piperazin-1-yl]methanone.
| Compound Name | [7-[(2-chloro-4-fluorophenyl)methylamino]-2,3-dimethyl-1H-indol-5-yl]-[4-(2-methoxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 142593197 |
| Molecular Formula | C25H30ClFN4O2 |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | [7-[(2-chloro-4-fluorophenyl)methylamino]-2,3-dimethyl-1H-indol-5-yl]-[4-(2-methoxyethyl)piperazin-1-yl]methanone |
| SMILES | COCCN1CCN(C(=O)c2cc(NCc3ccc(F)cc3Cl)c3[nH]c(C)c(C)c3c2)CC1 |
| InChI | InChI=1S/C25H30ClFN4O2/c1-16-17(2)29-24-21(16)12-19(25(32)31-8-6-30(7-9-31)10-11-33-3)13-23(24)28-15-18-4-5-20(27)14-22(18)26/h4-5,12-14,28-29H,6-11,15H2,1-3H3 |
| InChIKey | SMOZXVBYNHRJJW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|