C27H36N4O2 — CID 142593211
[7-[(2-ethyl-6-methylphenyl)methylamino]-2,3-dimethyl-1H-indol-5-yl]-[3-(2-methoxyethylamino)azetidin-1-yl]methanone (PubChem CID 142593211) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is [7-[(2-ethyl-6-methylphenyl)methylamino]-2,3-dimethyl-1H-indol-5-yl]-[3-(2-methoxyethylamino)azetidin-1-yl]methanone.
| Compound Name | [7-[(2-ethyl-6-methylphenyl)methylamino]-2,3-dimethyl-1H-indol-5-yl]-[3-(2-methoxyethylamino)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 142593211 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | [7-[(2-ethyl-6-methylphenyl)methylamino]-2,3-dimethyl-1H-indol-5-yl]-[3-(2-methoxyethylamino)azetidin-1-yl]methanone |
| SMILES | CCc1cccc(C)c1CNc1cc(C(=O)N2CC(NCCOC)C2)cc2c(C)c(C)[nH]c12 |
| InChI | InChI=1S/C27H36N4O2/c1-6-20-9-7-8-17(2)24(20)14-29-25-13-21(12-23-18(3)19(4)30-26(23)25)27(32)31-15-22(16-31)28-10-11-33-5/h7-9,12-13,22,28-30H,6,10-11,14-16H2,1-5H3 |
| InChIKey | OOQRRSGESYHFNP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|