C23H28ClN3O4S — CID 55970681
[4-(4-chlorophenyl)piperazin-1-yl]-(4-ethyl-3-morpholin-4-ylsulfonylphenyl)methanone (PubChem CID 55970681) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is [4-(4-chlorophenyl)piperazin-1-yl]-(4-ethyl-3-morpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | [4-(4-chlorophenyl)piperazin-1-yl]-(4-ethyl-3-morpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 55970681 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | [4-(4-chlorophenyl)piperazin-1-yl]-(4-ethyl-3-morpholin-4-ylsulfonylphenyl)methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(c3ccc(Cl)cc3)CC2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H28ClN3O4S/c1-2-18-3-4-19(17-22(18)32(29,30)27-13-15-31-16-14-27)23(28)26-11-9-25(10-12-26)21-7-5-20(24)6-8-21/h3-8,17H,2,9-16H2,1H3 |
| InChIKey | WHMFSXKPTWOUJM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |