C24H32N4O4S — CID 30840501
4-ethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 30840501) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is 4-ethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-ethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 30840501 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 4-ethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H32N4O4S/c1-3-19-4-5-20(18-23(19)33(30,31)28-14-16-32-17-15-28)24(29)25-21-6-8-22(9-7-21)27-12-10-26(2)11-13-27/h4-9,18H,3,10-17H2,1-2H3,(H,25,29) |
| InChIKey | ZOBTZMYGDKQXJD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|