C20H20F2N2O6S — CID 30838075
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-ethyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 30838075) has the molecular formula C20H20F2N2O6S and a molecular weight of 454.45 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-ethyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-ethyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 30838075 |
| Molecular Formula | C20H20F2N2O6S |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-ethyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc3c(c2)OC(F)(F)O3)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H20F2N2O6S/c1-2-13-3-4-14(11-18(13)31(26,27)24-7-9-28-10-8-24)19(25)23-15-5-6-16-17(12-15)30-20(21,22)29-16/h3-6,11-12H,2,7-10H2,1H3,(H,23,25) |
| InChIKey | RZEUYURJPHGVQO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |