C19H26N4O4S2 — CID 46581642
N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-ethyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 46581642) has the molecular formula C19H26N4O4S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-ethyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-ethyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46581642 |
| Molecular Formula | C19H26N4O4S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-ethyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCCCc1nnc(NC(=O)c2ccc(CC)c(S(=O)(=O)N3CCOCC3)c2)s1 |
| InChI | InChI=1S/C19H26N4O4S2/c1-3-5-6-17-21-22-19(28-17)20-18(24)15-8-7-14(4-2)16(13-15)29(25,26)23-9-11-27-12-10-23/h7-8,13H,3-6,9-12H2,1-2H3,(H,20,22,24) |
| InChIKey | OJBYJFOODWXWAX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |