C22H25N3O6S2 — CID 30838242
N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-4-ethyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 30838242) has the molecular formula C22H25N3O6S2 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-4-ethyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-4-ethyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 30838242 |
| Molecular Formula | C22H25N3O6S2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-4-ethyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCc1ccc(C(=O)Nc2nc3cc(OC)c(OC)cc3s2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H25N3O6S2/c1-4-14-5-6-15(11-20(14)33(27,28)25-7-9-31-10-8-25)21(26)24-22-23-16-12-17(29-2)18(30-3)13-19(16)32-22/h5-6,11-13H,4,7-10H2,1-3H3,(H,23,24,26) |
| InChIKey | IIZWMDJHVJABCM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |