C22H31N3O6S — CID 55578649
[4-(4-ethyl-3-morpholin-4-ylsulfonylbenzoyl)piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 55578649) has the molecular formula C22H31N3O6S and a molecular weight of 465.57 g/mol. Its IUPAC name is [4-(4-ethyl-3-morpholin-4-ylsulfonylbenzoyl)piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-(4-ethyl-3-morpholin-4-ylsulfonylbenzoyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 55578649 |
| Molecular Formula | C22H31N3O6S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [4-(4-ethyl-3-morpholin-4-ylsulfonylbenzoyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)C3CCCO3)CC2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H31N3O6S/c1-2-17-5-6-18(16-20(17)32(28,29)25-11-14-30-15-12-25)21(26)23-7-9-24(10-8-23)22(27)19-4-3-13-31-19/h5-6,16,19H,2-4,7-15H2,1H3 |
| InChIKey | WYHQEDXJGMADPZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |