C25H30N4O5S — CID 55575751
3-[1-(4-ethyl-3-morpholin-4-ylsulfonylbenzoyl)piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 55575751) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is 3-[1-(4-ethyl-3-morpholin-4-ylsulfonylbenzoyl)piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-(4-ethyl-3-morpholin-4-ylsulfonylbenzoyl)piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 55575751 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 3-[1-(4-ethyl-3-morpholin-4-ylsulfonylbenzoyl)piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | CCc1ccc(C(=O)N2CCC(n3c(=O)[nH]c4ccccc43)CC2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H30N4O5S/c1-2-18-7-8-19(17-23(18)35(32,33)28-13-15-34-16-14-28)24(30)27-11-9-20(10-12-27)29-22-6-4-3-5-21(22)26-25(29)31/h3-8,17,20H,2,9-16H2,1H3,(H,26,31) |
| InChIKey | GHBIKYZXNPQZAX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |