C13H16ClNO4S — CID 65370060
2-ethyl-5-(morpholine-4-carbonyl)benzenesulfonyl chloride (PubChem CID 65370060) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is 2-ethyl-5-(morpholine-4-carbonyl)benzenesulfonyl chloride.
| Compound Name | 2-ethyl-5-(morpholine-4-carbonyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65370060 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-ethyl-5-(morpholine-4-carbonyl)benzenesulfonyl chloride |
| SMILES | CCc1ccc(C(=O)N2CCOCC2)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C13H16ClNO4S/c1-2-10-3-4-11(9-12(10)20(14,17)18)13(16)15-5-7-19-8-6-15/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | JLASGCCUKJMGSS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |