C22H26ClN3O5S — CID 2207423
(4-chloro-3-morpholin-4-ylsulfonylphenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 2207423) has the molecular formula C22H26ClN3O5S and a molecular weight of 479.99 g/mol. Its IUPAC name is (4-chloro-3-morpholin-4-ylsulfonylphenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (4-chloro-3-morpholin-4-ylsulfonylphenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2207423 |
| Molecular Formula | C22H26ClN3O5S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | (4-chloro-3-morpholin-4-ylsulfonylphenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccccc1N1CCN(C(=O)c2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C22H26ClN3O5S/c1-30-20-5-3-2-4-19(20)24-8-10-25(11-9-24)22(27)17-6-7-18(23)21(16-17)32(28,29)26-12-14-31-15-13-26/h2-7,16H,8-15H2,1H3 |
| InChIKey | PAQSNUIWHONFDK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |