C19H19N3O3 — CID 110388164
1,3-benzoxazol-5-yl-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 110388164) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1,3-benzoxazol-5-yl-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | 1,3-benzoxazol-5-yl-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110388164 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1,3-benzoxazol-5-yl-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc4ocnc4c3)CC2)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-24-16-5-3-15(4-6-16)21-8-10-22(11-9-21)19(23)14-2-7-18-17(12-14)20-13-25-18/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | KNDQRGZEMCIHAM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|