C14H15N3O4 — CID 110399443
methyl 4-(1,3-benzoxazole-5-carbonyl)piperazine-1-carboxylate (PubChem CID 110399443) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is methyl 4-(1,3-benzoxazole-5-carbonyl)piperazine-1-carboxylate.
| Compound Name | methyl 4-(1,3-benzoxazole-5-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110399443 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | methyl 4-(1,3-benzoxazole-5-carbonyl)piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)c2ccc3ocnc3c2)CC1 |
| InChI | InChI=1S/C14H15N3O4/c1-20-14(19)17-6-4-16(5-7-17)13(18)10-2-3-12-11(8-10)15-9-21-12/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | BZWMOPFREIYVFY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |