C10H9NO2 — CID 119084710
1-(1,3-benzoxazol-5-yl)propan-1-one (PubChem CID 119084710) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-5-yl)propan-1-one.
| Compound Name | 1-(1,3-benzoxazol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 119084710 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 1-(1,3-benzoxazol-5-yl)propan-1-one |
| SMILES | CCC(=O)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C10H9NO2/c1-2-9(12)7-3-4-10-8(5-7)11-6-13-10/h3-6H,2H2,1H3 |
| InChIKey | NGRLZAHLFVUMMC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |