C18H15NO3 — CID 90363778
1-(1,3-benzoxazol-5-yl)-4-(4-methylphenyl)butane-1,4-dione (PubChem CID 90363778) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-5-yl)-4-(4-methylphenyl)butane-1,4-dione.
| Compound Name | 1-(1,3-benzoxazol-5-yl)-4-(4-methylphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 90363778 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-(1,3-benzoxazol-5-yl)-4-(4-methylphenyl)butane-1,4-dione |
| SMILES | Cc1ccc(C(=O)CCC(=O)c2ccc3ocnc3c2)cc1 |
| InChI | InChI=1S/C18H15NO3/c1-12-2-4-13(5-3-12)16(20)7-8-17(21)14-6-9-18-15(10-14)19-11-22-18/h2-6,9-11H,7-8H2,1H3 |
| InChIKey | VTIFRDNXZGDAEH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |