[2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate

C17H14N2O4 — CID 23773443

IUPAC[2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate
SMILESCc1ccc(NC(=O)COC(=O)c2ccc3ocnc3c2)cc1
InChIInChI=1S/C17H14N2O4/c1-11-2-5-13(6-3-11)19-16(20)9-22-17(21)12-4-7-15-14(8-12)18-10-23-15/h2-8,10H,9H2,1H3,(H,19,20)
InChIKeyJQRZUJOGDODMJT-UHFFFAOYSA-N
MW310.31 g/mol
LogP2.93
Rot. Bonds4

About [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate

[2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate (PubChem CID 23773443) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate.

Molecular Properties

Compound Name[2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate
PubChem CID23773443
Molecular FormulaC17H14N2O4
Molecular Weight310.31 g/mol
Exact Mass310.10
IUPAC Name[2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate
SMILESCc1ccc(NC(=O)COC(=O)c2ccc3ocnc3c2)cc1
InChIInChI=1S/C17H14N2O4/c1-11-2-5-13(6-3-11)19-16(20)9-22-17(21)12-4-7-15-14(8-12)18-10-23-15/h2-8,10H,9H2,1H3,(H,19,20)
InChIKeyJQRZUJOGDODMJT-UHFFFAOYSA-N
XLogP2.93
TPSA81.43 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.31
LogP ≤ 52.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate?
The IUPAC name of [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate (CID 23773443) is [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate.
What is the SMILES notation for [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate?
The canonical SMILES for [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate is Cc1ccc(NC(=O)COC(=O)c2ccc3ocnc3c2)cc1.
What is the InChIKey of [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate?
The InChIKey is JQRZUJOGDODMJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O4/c1-11-2-5-13(6-3-11)19-16(20)9-22-17(21)12-4-7-15-14(8-12)18-10-23-15/h2-8,10H,9H2,1H3,(H,19,20).
What are the key properties of [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate?
[2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate has a molecular weight of 310.31 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate is sourced from PubChem (CID 23773443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).