C17H14N2O4 — CID 23773443
[2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate (PubChem CID 23773443) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 23773443 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 1,3-benzoxazole-5-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc3ocnc3c2)cc1 |
| InChI | InChI=1S/C17H14N2O4/c1-11-2-5-13(6-3-11)19-16(20)9-22-17(21)12-4-7-15-14(8-12)18-10-23-15/h2-8,10H,9H2,1H3,(H,19,20) |
| InChIKey | JQRZUJOGDODMJT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |