[2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate

C16H11ClN2O4 — CID 23999281

IUPAC[2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate
SMILESO=C(COC(=O)c1ccc2ncoc2c1)Nc1cccc(Cl)c1
InChIInChI=1S/C16H11ClN2O4/c17-11-2-1-3-12(7-11)19-15(20)8-22-16(21)10-4-5-13-14(6-10)23-9-18-13/h1-7,9H,8H2,(H,19,20)
InChIKeyAARZYZQHTYCUDV-UHFFFAOYSA-N
MW330.73 g/mol
LogP3.28
Rot. Bonds4

About [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate

[2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate (PubChem CID 23999281) has the molecular formula C16H11ClN2O4 and a molecular weight of 330.73 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate.

Molecular Properties

Compound Name[2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate
PubChem CID23999281
Molecular FormulaC16H11ClN2O4
Molecular Weight330.73 g/mol
Exact Mass330.04
IUPAC Name[2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate
SMILESO=C(COC(=O)c1ccc2ncoc2c1)Nc1cccc(Cl)c1
InChIInChI=1S/C16H11ClN2O4/c17-11-2-1-3-12(7-11)19-15(20)8-22-16(21)10-4-5-13-14(6-10)23-9-18-13/h1-7,9H,8H2,(H,19,20)
InChIKeyAARZYZQHTYCUDV-UHFFFAOYSA-N
XLogP3.28
TPSA81.43 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.73
LogP ≤ 53.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate?
The IUPAC name of [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate (CID 23999281) is [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate.
What is the SMILES notation for [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate?
The canonical SMILES for [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate is O=C(COC(=O)c1ccc2ncoc2c1)Nc1cccc(Cl)c1.
What is the InChIKey of [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate?
The InChIKey is AARZYZQHTYCUDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2O4/c17-11-2-1-3-12(7-11)19-15(20)8-22-16(21)10-4-5-13-14(6-10)23-9-18-13/h1-7,9H,8H2,(H,19,20).
What are the key properties of [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate?
[2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate has a molecular weight of 330.73 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate is sourced from PubChem (CID 23999281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).