C16H11ClN2O4 — CID 23999281
[2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate (PubChem CID 23999281) has the molecular formula C16H11ClN2O4 and a molecular weight of 330.73 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 23999281 |
| Molecular Formula | C16H11ClN2O4 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 1,3-benzoxazole-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2ncoc2c1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H11ClN2O4/c17-11-2-1-3-12(7-11)19-15(20)8-22-16(21)10-4-5-13-14(6-10)23-9-18-13/h1-7,9H,8H2,(H,19,20) |
| InChIKey | AARZYZQHTYCUDV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |