C13H12ClN3O3 — CID 46860354
[2-[(5-methyl-1H-pyrazol-3-yl)amino]-2-oxoethyl] 3-chlorobenzoate (PubChem CID 46860354) has the molecular formula C13H12ClN3O3 and a molecular weight of 293.71 g/mol. Its IUPAC name is [2-[(5-methyl-1H-pyrazol-3-yl)amino]-2-oxoethyl] 3-chlorobenzoate.
| Compound Name | [2-[(5-methyl-1H-pyrazol-3-yl)amino]-2-oxoethyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 46860354 |
| Molecular Formula | C13H12ClN3O3 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | [2-[(5-methyl-1H-pyrazol-3-yl)amino]-2-oxoethyl] 3-chlorobenzoate |
| SMILES | Cc1cc(NC(=O)COC(=O)c2cccc(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C13H12ClN3O3/c1-8-5-11(17-16-8)15-12(18)7-20-13(19)9-3-2-4-10(14)6-9/h2-6H,7H2,1H3,(H2,15,16,17,18) |
| InChIKey | PPRNJSONTALHDX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |