C15H11N3O3 — CID 90363784
1-(1,3-benzoxazol-5-yl)-4-pyridazin-3-ylbutane-1,4-dione (PubChem CID 90363784) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-5-yl)-4-pyridazin-3-ylbutane-1,4-dione.
| Compound Name | 1-(1,3-benzoxazol-5-yl)-4-pyridazin-3-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 90363784 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-(1,3-benzoxazol-5-yl)-4-pyridazin-3-ylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)c1cccnn1)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C15H11N3O3/c19-13(4-5-14(20)11-2-1-7-17-18-11)10-3-6-15-12(8-10)16-9-21-15/h1-3,6-9H,4-5H2 |
| InChIKey | RTTFABJXVCWGNZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 85.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |