C20H21NO4 — CID 144689456
1-(1,3-benzoxazol-5-yl)-4-(2-methoxyphenyl)butane-1,4-dione;ethane (PubChem CID 144689456) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-5-yl)-4-(2-methoxyphenyl)butane-1,4-dione;ethane.
| Compound Name | 1-(1,3-benzoxazol-5-yl)-4-(2-methoxyphenyl)butane-1,4-dione;ethane |
|---|---|
| PubChem CID | 144689456 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-(1,3-benzoxazol-5-yl)-4-(2-methoxyphenyl)butane-1,4-dione;ethane |
| SMILES | CC.COc1ccccc1C(=O)CCC(=O)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C18H15NO4.C2H6/c1-22-17-5-3-2-4-13(17)16(21)8-7-15(20)12-6-9-18-14(10-12)19-11-23-18;1-2/h2-6,9-11H,7-8H2,1H3;1-2H3 |
| InChIKey | ZDCSKWOTVBIABM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |