C15H15NO3 — CID 142933115
1,3-benzoxazole;1,2-dimethoxybenzene (PubChem CID 142933115) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1,3-benzoxazole;1,2-dimethoxybenzene.
| Compound Name | 1,3-benzoxazole;1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 142933115 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1,3-benzoxazole;1,2-dimethoxybenzene |
| SMILES | COc1ccccc1OC.c1ccc2ocnc2c1 |
| InChI | InChI=1S/C8H10O2.C7H5NO/c1-9-7-5-3-4-6-8(7)10-2;1-2-4-7-6(3-1)8-5-9-7/h3-6H,1-2H3;1-5H |
| InChIKey | IIGKDBQFMMNQDS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |