About bis(1,3-benzoxazole);stilbene
bis(1,3-benzoxazole);stilbene (PubChem CID 66914199) has the molecular formula C28H22N2O2
and a molecular weight of 418.50 g/mol. Its IUPAC name is bis(1,3-benzoxazole);stilbene.
Molecular Properties
| Compound Name | bis(1,3-benzoxazole);stilbene |
| PubChem CID | 66914199 |
| Molecular Formula | C28H22N2O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | bis(1,3-benzoxazole);stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.c1ccc2ocnc2c1.c1ccc2ocnc2c1 |
| InChI | InChI=1S/C14H12.2C7H5NO/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;2*1-2-4-7-6(3-1)8-5-9-7/h1-12H;2*1-5H |
| InChIKey | ALNDHUXNYOMYIH-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze bis(1,3-benzoxazole);stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,3-benzoxazole);stilbene?
The IUPAC name of bis(1,3-benzoxazole);stilbene (CID 66914199) is bis(1,3-benzoxazole);stilbene.
What is the SMILES notation for bis(1,3-benzoxazole);stilbene?
The canonical SMILES for bis(1,3-benzoxazole);stilbene is C(=Cc1ccccc1)c1ccccc1.c1ccc2ocnc2c1.c1ccc2ocnc2c1.
What is the InChIKey of bis(1,3-benzoxazole);stilbene?
The InChIKey is ALNDHUXNYOMYIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.2C7H5NO/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;2*1-2-4-7-6(3-1)8-5-9-7/h1-12H;2*1-5H.
What are the key properties of bis(1,3-benzoxazole);stilbene?
bis(1,3-benzoxazole);stilbene has a molecular weight of 418.50 g/mol, XLogP of 7.51, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,3-benzoxazole);stilbene is sourced from PubChem (CID 66914199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).