About 1,3-benzoxazole;quinoline
1,3-benzoxazole;quinoline (PubChem CID 87081350) has the molecular formula C16H12N2O
and a molecular weight of 248.29 g/mol. Its IUPAC name is 1,3-benzoxazole;quinoline.
Molecular Properties
| Compound Name | 1,3-benzoxazole;quinoline |
| PubChem CID | 87081350 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 1,3-benzoxazole;quinoline |
| SMILES | c1ccc2ncccc2c1.c1ccc2ocnc2c1 |
| InChI | InChI=1S/C9H7N.C7H5NO/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-7-6(3-1)8-5-9-7/h1-7H;1-5H |
| InChIKey | AKQIJUCZWUAMNJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-benzoxazole;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzoxazole;quinoline?
The IUPAC name of 1,3-benzoxazole;quinoline (CID 87081350) is 1,3-benzoxazole;quinoline.
What is the SMILES notation for 1,3-benzoxazole;quinoline?
The canonical SMILES for 1,3-benzoxazole;quinoline is c1ccc2ncccc2c1.c1ccc2ocnc2c1.
What is the InChIKey of 1,3-benzoxazole;quinoline?
The InChIKey is AKQIJUCZWUAMNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C7H5NO/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-7-6(3-1)8-5-9-7/h1-7H;1-5H.
What are the key properties of 1,3-benzoxazole;quinoline?
1,3-benzoxazole;quinoline has a molecular weight of 248.29 g/mol, XLogP of 4.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzoxazole;quinoline is sourced from PubChem (CID 87081350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).