C12H14N2O2 — CID 110388151
N-tert-butyl-1,3-benzoxazole-5-carboxamide (PubChem CID 110388151) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is N-tert-butyl-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-tert-butyl-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 110388151 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-tert-butyl-1,3-benzoxazole-5-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C12H14N2O2/c1-12(2,3)14-11(15)8-4-5-10-9(6-8)13-7-16-10/h4-7H,1-3H3,(H,14,15) |
| InChIKey | SQYKLTMLMBHRDF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |