C13H16N2O3 — CID 108795171
N-(5-hydroxypentyl)-1,3-benzoxazole-5-carboxamide (PubChem CID 108795171) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-(5-hydroxypentyl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 108795171 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-(5-hydroxypentyl)-1,3-benzoxazole-5-carboxamide |
| SMILES | O=C(NCCCCCO)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C13H16N2O3/c16-7-3-1-2-6-14-13(17)10-4-5-12-11(8-10)15-9-18-12/h4-5,8-9,16H,1-3,6-7H2,(H,14,17) |
| InChIKey | RIGITGWFSLJGDO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|