C14H19N3O2 — CID 108795126
N-(6-aminohexyl)-1,3-benzoxazole-5-carboxamide (PubChem CID 108795126) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-(6-aminohexyl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-(6-aminohexyl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 108795126 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-(6-aminohexyl)-1,3-benzoxazole-5-carboxamide |
| SMILES | NCCCCCCNC(=O)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C14H19N3O2/c15-7-3-1-2-4-8-16-14(18)11-5-6-13-12(9-11)17-10-19-13/h5-6,9-10H,1-4,7-8,15H2,(H,16,18) |
| InChIKey | IKWRIHKTZVOXSW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|