C17H24N6O — CID 87330668
N-(6-aminohexyl)-3-[(6-aminopyrimidin-4-yl)amino]benzamide (PubChem CID 87330668) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is N-(6-aminohexyl)-3-[(6-aminopyrimidin-4-yl)amino]benzamide.
| Compound Name | N-(6-aminohexyl)-3-[(6-aminopyrimidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 87330668 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-(6-aminohexyl)-3-[(6-aminopyrimidin-4-yl)amino]benzamide |
| SMILES | NCCCCCCNC(=O)c1cccc(Nc2cc(N)ncn2)c1 |
| InChI | InChI=1S/C17H24N6O/c18-8-3-1-2-4-9-20-17(24)13-6-5-7-14(10-13)23-16-11-15(19)21-12-22-16/h5-7,10-12H,1-4,8-9,18H2,(H,20,24)(H3,19,21,22,23) |
| InChIKey | JHWJNTFZTJCMIL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|