C12H14N4O2 — CID 119407873
N-(3-aminopropyl)-4-(1,2,4-oxadiazol-3-yl)benzamide (PubChem CID 119407873) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-(1,2,4-oxadiazol-3-yl)benzamide.
| Compound Name | N-(3-aminopropyl)-4-(1,2,4-oxadiazol-3-yl)benzamide |
|---|---|
| PubChem CID | 119407873 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | N-(3-aminopropyl)-4-(1,2,4-oxadiazol-3-yl)benzamide |
| SMILES | NCCCNC(=O)c1ccc(-c2ncon2)cc1 |
| InChI | InChI=1S/C12H14N4O2/c13-6-1-7-14-12(17)10-4-2-9(3-5-10)11-15-8-18-16-11/h2-5,8H,1,6-7,13H2,(H,14,17) |
| InChIKey | BMAYJAUCOHWGOB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|