C14H17N3O3 — CID 107318774
N-(5-hydroxypentyl)-4-(1,3,4-oxadiazol-2-yl)benzamide (PubChem CID 107318774) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-4-(1,3,4-oxadiazol-2-yl)benzamide.
| Compound Name | N-(5-hydroxypentyl)-4-(1,3,4-oxadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 107318774 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(5-hydroxypentyl)-4-(1,3,4-oxadiazol-2-yl)benzamide |
| SMILES | O=C(NCCCCCO)c1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C14H17N3O3/c18-9-3-1-2-8-15-13(19)11-4-6-12(7-5-11)14-17-16-10-20-14/h4-7,10,18H,1-3,8-9H2,(H,15,19) |
| InChIKey | QHDWFWHIFPTFNK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|